C14H21BFNO4 — CID 64535556
[5-fluoro-2-[(4-propan-2-ylmorpholin-2-yl)methoxy]phenyl]boronic acid (PubChem CID 64535556) has the molecular formula C14H21BFNO4 and a molecular weight of 297.13 g/mol. Its IUPAC name is [5-fluoro-2-[(4-propan-2-ylmorpholin-2-yl)methoxy]phenyl]boronic acid.
| Compound Name | [5-fluoro-2-[(4-propan-2-ylmorpholin-2-yl)methoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 64535556 |
| Molecular Formula | C14H21BFNO4 |
| Molecular Weight | 297.13 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [5-fluoro-2-[(4-propan-2-ylmorpholin-2-yl)methoxy]phenyl]boronic acid |
| SMILES | CC(C)N1CCOC(COc2ccc(F)cc2B(O)O)C1 |
| InChI | InChI=1S/C14H21BFNO4/c1-10(2)17-5-6-20-12(8-17)9-21-14-4-3-11(16)7-13(14)15(18)19/h3-4,7,10,12,18-19H,5-6,8-9H2,1-2H3 |
| InChIKey | HZQKPFNAHAQJOX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.13 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|