C16H25NO2 — CID 103432287
2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-ylmorpholine (PubChem CID 103432287) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-ylmorpholine.
| Compound Name | 2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 103432287 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-ylmorpholine |
| SMILES | Cc1cccc(OCC2CN(C(C)C)CCO2)c1C |
| InChI | InChI=1S/C16H25NO2/c1-12(2)17-8-9-18-15(10-17)11-19-16-7-5-6-13(3)14(16)4/h5-7,12,15H,8-11H2,1-4H3 |
| InChIKey | LIRHKCVFBMFRIH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |