C18H25NO2 — CID 12800263
2-[(1-methyl-3H-inden-4-yl)oxymethyl]-4-propan-2-ylmorpholine (PubChem CID 12800263) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-[(1-methyl-3H-inden-4-yl)oxymethyl]-4-propan-2-ylmorpholine.
| Compound Name | 2-[(1-methyl-3H-inden-4-yl)oxymethyl]-4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 12800263 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-[(1-methyl-3H-inden-4-yl)oxymethyl]-4-propan-2-ylmorpholine |
| SMILES | CC1=CCc2c(OCC3CN(C(C)C)CCO3)cccc21 |
| InChI | InChI=1S/C18H25NO2/c1-13(2)19-9-10-20-15(11-19)12-21-18-6-4-5-16-14(3)7-8-17(16)18/h4-7,13,15H,8-12H2,1-3H3 |
| InChIKey | USJWEKQRLIWATG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |