C15H24BNO4 — CID 64535557
[3-methyl-4-[(4-propan-2-ylmorpholin-2-yl)methoxy]phenyl]boronic acid (PubChem CID 64535557) has the molecular formula C15H24BNO4 and a molecular weight of 293.17 g/mol. Its IUPAC name is [3-methyl-4-[(4-propan-2-ylmorpholin-2-yl)methoxy]phenyl]boronic acid.
| Compound Name | [3-methyl-4-[(4-propan-2-ylmorpholin-2-yl)methoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 64535557 |
| Molecular Formula | C15H24BNO4 |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | [3-methyl-4-[(4-propan-2-ylmorpholin-2-yl)methoxy]phenyl]boronic acid |
| SMILES | Cc1cc(B(O)O)ccc1OCC1CN(C(C)C)CCO1 |
| InChI | InChI=1S/C15H24BNO4/c1-11(2)17-6-7-20-14(9-17)10-21-15-5-4-13(16(18)19)8-12(15)3/h4-5,8,11,14,18-19H,6-7,9-10H2,1-3H3 |
| InChIKey | VWQPAJRMOMDWNF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|