C11H16N2O — CID 114396701
1-(2,3-dihydro-1H-isoindol-5-yl)-N-methoxy-N-methylmethanamine (PubChem CID 114396701) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-isoindol-5-yl)-N-methoxy-N-methylmethanamine.
| Compound Name | 1-(2,3-dihydro-1H-isoindol-5-yl)-N-methoxy-N-methylmethanamine |
|---|---|
| PubChem CID | 114396701 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(2,3-dihydro-1H-isoindol-5-yl)-N-methoxy-N-methylmethanamine |
| SMILES | CON(C)Cc1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C11H16N2O/c1-13(14-2)8-9-3-4-10-6-12-7-11(10)5-9/h3-5,12H,6-8H2,1-2H3 |
| InChIKey | QKJYSFPRERJDQY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|