C12H16N6O2S — CID 114397236
2-[[5-(methylamino)thiadiazol-4-yl]methyl]-5-morpholin-4-ylpyridazin-3-one (PubChem CID 114397236) has the molecular formula C12H16N6O2S and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-[[5-(methylamino)thiadiazol-4-yl]methyl]-5-morpholin-4-ylpyridazin-3-one.
| Compound Name | 2-[[5-(methylamino)thiadiazol-4-yl]methyl]-5-morpholin-4-ylpyridazin-3-one |
|---|---|
| PubChem CID | 114397236 |
| Molecular Formula | C12H16N6O2S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-[[5-(methylamino)thiadiazol-4-yl]methyl]-5-morpholin-4-ylpyridazin-3-one |
| SMILES | CNc1snnc1Cn1ncc(N2CCOCC2)cc1=O |
| InChI | InChI=1S/C12H16N6O2S/c1-13-12-10(15-16-21-12)8-18-11(19)6-9(7-14-18)17-2-4-20-5-3-17/h6-7,13H,2-5,8H2,1H3 |
| InChIKey | OBRSYMKJWAVBPS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |