C15H22N4O2 — CID 114397748
2-[2-(furan-2-ylmethylamino)ethyl]-5-[methyl(propyl)amino]pyridazin-3-one (PubChem CID 114397748) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[2-(furan-2-ylmethylamino)ethyl]-5-[methyl(propyl)amino]pyridazin-3-one.
| Compound Name | 2-[2-(furan-2-ylmethylamino)ethyl]-5-[methyl(propyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114397748 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[2-(furan-2-ylmethylamino)ethyl]-5-[methyl(propyl)amino]pyridazin-3-one |
| SMILES | CCCN(C)c1cnn(CCNCc2ccco2)c(=O)c1 |
| InChI | InChI=1S/C15H22N4O2/c1-3-7-18(2)13-10-15(20)19(17-11-13)8-6-16-12-14-5-4-9-21-14/h4-5,9-11,16H,3,6-8,12H2,1-2H3 |
| InChIKey | KICDAZRFQDZUAP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|