C17H30O6Si — CID 11439780
tert-butyl [(2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-2-yl] carbonate (PubChem CID 11439780) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is tert-butyl [(2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-2-yl] carbonate.
| Compound Name | tert-butyl [(2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-2-yl] carbonate |
|---|---|
| PubChem CID | 11439780 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | tert-butyl [(2S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2H-pyran-2-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)O[C@H]1C=CC(=O)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C17H30O6Si/c1-16(2,3)23-15(19)22-14-10-9-12(18)13(21-14)11-20-24(7,8)17(4,5)6/h9-10,13-14H,11H2,1-8H3/t13-,14-/m0/s1 |
| InChIKey | JZUINNRSCUVZPL-KBPBESRZSA-N |
| XLogP | 3.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|