C11H16BF3N3O2- — CID 114398773
[4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]methyl-trifluoroboranuide (PubChem CID 114398773) has the molecular formula C11H16BF3N3O2- and a molecular weight of 290.07 g/mol. Its IUPAC name is [4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]methyl-trifluoroboranuide.
| Compound Name | [4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 114398773 |
| Molecular Formula | C11H16BF3N3O2- |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]methyl-trifluoroboranuide |
| SMILES | CC1(C)CN(c2cnn(C[B-](F)(F)F)c(=O)c2)CCO1 |
| InChI | InChI=1S/C11H16BF3N3O2/c1-11(2)7-17(3-4-20-11)9-5-10(19)18(16-6-9)8-12(13,14)15/h5-6H,3-4,7-8H2,1-2H3/q-1 |
| InChIKey | WXMYXBSFUBILMD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|