C9H14BF3N3O2- — CID 114398760
trifluoro-[[4-[2-methoxyethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]boranuide (PubChem CID 114398760) has the molecular formula C9H14BF3N3O2- and a molecular weight of 264.04 g/mol. Its IUPAC name is trifluoro-[[4-[2-methoxyethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]boranuide.
| Compound Name | trifluoro-[[4-[2-methoxyethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]boranuide |
|---|---|
| PubChem CID | 114398760 |
| Molecular Formula | C9H14BF3N3O2- |
| Molecular Weight | 264.04 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | trifluoro-[[4-[2-methoxyethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]boranuide |
| SMILES | COCCN(C)c1cnn(C[B-](F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C9H14BF3N3O2/c1-15(3-4-18-2)8-5-9(17)16(14-6-8)7-10(11,12)13/h5-6H,3-4,7H2,1-2H3/q-1 |
| InChIKey | JFAQKMBDICFVMJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.04 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|