C10H14BF3N3O- — CID 106746478
3-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746478) has the molecular formula C10H14BF3N3O- and a molecular weight of 260.05 g/mol. Its IUPAC name is 3-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746478 |
| Molecular Formula | C10H14BF3N3O- |
| Molecular Weight | 260.05 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(Cn1ncc(N(C)CC)cc1=O)[B-](F)(F)F |
| InChI | InChI=1S/C10H14BF3N3O/c1-4-16(3)9-5-10(18)17(15-6-9)7-8(2)11(12,13)14/h5-6H,2,4,7H2,1,3H3/q-1 |
| InChIKey | MONNERGZDZQORN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.05 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|