C10H12F5N3O — CID 28871573
5-(dimethylamino)-2-(3,3,4,4,4-pentafluorobutyl)pyridazin-3-one (PubChem CID 28871573) has the molecular formula C10H12F5N3O and a molecular weight of 285.22 g/mol. Its IUPAC name is 5-(dimethylamino)-2-(3,3,4,4,4-pentafluorobutyl)pyridazin-3-one.
| Compound Name | 5-(dimethylamino)-2-(3,3,4,4,4-pentafluorobutyl)pyridazin-3-one |
|---|---|
| PubChem CID | 28871573 |
| Molecular Formula | C10H12F5N3O |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-(dimethylamino)-2-(3,3,4,4,4-pentafluorobutyl)pyridazin-3-one |
| SMILES | CN(C)c1cnn(CCC(F)(F)C(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C10H12F5N3O/c1-17(2)7-5-8(19)18(16-6-7)4-3-9(11,12)10(13,14)15/h5-6H,3-4H2,1-2H3 |
| InChIKey | ILCSQDIJZFJHPN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|