C14H17FN4O — CID 114397466
5-(dimethylamino)-2-[2-(3-fluoroanilino)ethyl]pyridazin-3-one (PubChem CID 114397466) has the molecular formula C14H17FN4O and a molecular weight of 276.31 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[2-(3-fluoroanilino)ethyl]pyridazin-3-one.
| Compound Name | 5-(dimethylamino)-2-[2-(3-fluoroanilino)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114397466 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 5-(dimethylamino)-2-[2-(3-fluoroanilino)ethyl]pyridazin-3-one |
| SMILES | CN(C)c1cnn(CCNc2cccc(F)c2)c(=O)c1 |
| InChI | InChI=1S/C14H17FN4O/c1-18(2)13-9-14(20)19(17-10-13)7-6-16-12-5-3-4-11(15)8-12/h3-5,8-10,16H,6-7H2,1-2H3 |
| InChIKey | UHWKYIQXHPJNQW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |