C9H12BF3KN3O — CID 106746469
potassium 3-[4-(dimethylamino)-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746469) has the molecular formula C9H12BF3KN3O and a molecular weight of 285.12 g/mol. Its IUPAC name is potassium 3-[4-(dimethylamino)-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | potassium 3-[4-(dimethylamino)-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746469 |
| Molecular Formula | C9H12BF3KN3O |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | potassium 3-[4-(dimethylamino)-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(Cn1ncc(N(C)C)cc1=O)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C9H12BF3N3O.K/c1-7(10(11,12)13)6-16-9(17)4-8(5-14-16)15(2)3;/h4-5H,1,6H2,2-3H3;/q-1;+1 |
| InChIKey | STQNYFJMXNETIN-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|