C10H15BF3N4O- — CID 114398758
trifluoro-[[4-(4-methylpiperazin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide (PubChem CID 114398758) has the molecular formula C10H15BF3N4O- and a molecular weight of 275.06 g/mol. Its IUPAC name is trifluoro-[[4-(4-methylpiperazin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide.
| Compound Name | trifluoro-[[4-(4-methylpiperazin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide |
|---|---|
| PubChem CID | 114398758 |
| Molecular Formula | C10H15BF3N4O- |
| Molecular Weight | 275.06 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | trifluoro-[[4-(4-methylpiperazin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide |
| SMILES | CN1CCN(c2cnn(C[B-](F)(F)F)c(=O)c2)CC1 |
| InChI | InChI=1S/C10H15BF3N4O/c1-16-2-4-17(5-3-16)9-6-10(19)18(15-7-9)8-11(12,13)14/h6-7H,2-5,8H2,1H3/q-1 |
| InChIKey | IUMDLUOKVHFLKL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.06 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|