C8H12BF3N3O- — CID 114398763
[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl-trifluoroboranuide (PubChem CID 114398763) has the molecular formula C8H12BF3N3O- and a molecular weight of 234.01 g/mol. Its IUPAC name is [4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl-trifluoroboranuide.
| Compound Name | [4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 114398763 |
| Molecular Formula | C8H12BF3N3O- |
| Molecular Weight | 234.01 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | [4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl-trifluoroboranuide |
| SMILES | CCN(C)c1cnn(C[B-](F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C8H12BF3N3O/c1-3-14(2)7-4-8(16)15(13-5-7)6-9(10,11)12/h4-5H,3,6H2,1-2H3/q-1 |
| InChIKey | DSYATNNUOQWRHN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.01 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|