C9H12BF3N3O- — CID 106746470
3-[4-(dimethylamino)-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746470) has the molecular formula C9H12BF3N3O- and a molecular weight of 246.02 g/mol. Its IUPAC name is 3-[4-(dimethylamino)-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-[4-(dimethylamino)-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746470 |
| Molecular Formula | C9H12BF3N3O- |
| Molecular Weight | 246.02 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-[4-(dimethylamino)-6-oxopyridazin-1-yl]prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(Cn1ncc(N(C)C)cc1=O)[B-](F)(F)F |
| InChI | InChI=1S/C9H12BF3N3O/c1-7(10(11,12)13)6-16-9(17)4-8(5-14-16)15(2)3/h4-5H,1,6H2,2-3H3/q-1 |
| InChIKey | SWSUQEQLVVLOIW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.02 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|