C13H26N4O2 — CID 114399910
N-[(4-ethylmorpholin-2-yl)methyl]-2-piperazin-1-ylacetamide (PubChem CID 114399910) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[(4-ethylmorpholin-2-yl)methyl]-2-piperazin-1-ylacetamide.
| Compound Name | N-[(4-ethylmorpholin-2-yl)methyl]-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 114399910 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-[(4-ethylmorpholin-2-yl)methyl]-2-piperazin-1-ylacetamide |
| SMILES | CCN1CCOC(CNC(=O)CN2CCNCC2)C1 |
| InChI | InChI=1S/C13H26N4O2/c1-2-16-7-8-19-12(10-16)9-15-13(18)11-17-5-3-14-4-6-17/h12,14H,2-11H2,1H3,(H,15,18) |
| InChIKey | KNFHUKHQUIYJSS-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |