C10H20N2O3 — CID 115629823
N-[(4-ethylmorpholin-2-yl)methyl]-2-methoxyacetamide (PubChem CID 115629823) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is N-[(4-ethylmorpholin-2-yl)methyl]-2-methoxyacetamide.
| Compound Name | N-[(4-ethylmorpholin-2-yl)methyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 115629823 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | N-[(4-ethylmorpholin-2-yl)methyl]-2-methoxyacetamide |
| SMILES | CCN1CCOC(CNC(=O)COC)C1 |
| InChI | InChI=1S/C10H20N2O3/c1-3-12-4-5-15-9(7-12)6-11-10(13)8-14-2/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | KXDWNAVBFMBQMA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |