C14H27N3O3 — CID 114400004
4-(ethylamino)-N-[(4-ethylmorpholin-2-yl)methyl]oxolane-3-carboxamide (PubChem CID 114400004) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-(ethylamino)-N-[(4-ethylmorpholin-2-yl)methyl]oxolane-3-carboxamide.
| Compound Name | 4-(ethylamino)-N-[(4-ethylmorpholin-2-yl)methyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 114400004 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 4-(ethylamino)-N-[(4-ethylmorpholin-2-yl)methyl]oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)NCC1CN(CC)CCO1 |
| InChI | InChI=1S/C14H27N3O3/c1-3-15-13-10-19-9-12(13)14(18)16-7-11-8-17(4-2)5-6-20-11/h11-13,15H,3-10H2,1-2H3,(H,16,18) |
| InChIKey | HXRKTFNESREZLY-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |