C13H25N3O5 — CID 114400938
4-[(4-ethylmorpholin-2-yl)methylcarbamoylamino]-3-hydroxy-3-methylbutanoic acid (PubChem CID 114400938) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-[(4-ethylmorpholin-2-yl)methylcarbamoylamino]-3-hydroxy-3-methylbutanoic acid.
| Compound Name | 4-[(4-ethylmorpholin-2-yl)methylcarbamoylamino]-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 114400938 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 4-[(4-ethylmorpholin-2-yl)methylcarbamoylamino]-3-hydroxy-3-methylbutanoic acid |
| SMILES | CCN1CCOC(CNC(=O)NCC(C)(O)CC(=O)O)C1 |
| InChI | InChI=1S/C13H25N3O5/c1-3-16-4-5-21-10(8-16)7-14-12(19)15-9-13(2,20)6-11(17)18/h10,20H,3-9H2,1-2H3,(H,17,18)(H2,14,15,19) |
| InChIKey | FCKWGIUONZHNBQ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |