C10H10F3N3O4 — CID 114403711
methyl 6-[methyl(2,2,2-trifluoroethyl)amino]-5-nitropyridine-2-carboxylate (PubChem CID 114403711) has the molecular formula C10H10F3N3O4 and a molecular weight of 293.20 g/mol. Its IUPAC name is methyl 6-[methyl(2,2,2-trifluoroethyl)amino]-5-nitropyridine-2-carboxylate.
| Compound Name | methyl 6-[methyl(2,2,2-trifluoroethyl)amino]-5-nitropyridine-2-carboxylate |
|---|---|
| PubChem CID | 114403711 |
| Molecular Formula | C10H10F3N3O4 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | methyl 6-[methyl(2,2,2-trifluoroethyl)amino]-5-nitropyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(N(C)CC(F)(F)F)n1 |
| InChI | InChI=1S/C10H10F3N3O4/c1-15(5-10(11,12)13)8-7(16(18)19)4-3-6(14-8)9(17)20-2/h3-4H,5H2,1-2H3 |
| InChIKey | DSMKUJABSCTXGU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|