C13H16N4O4 — CID 114403889
methyl 6-[2-cyanopropyl(ethyl)amino]-5-nitropyridine-2-carboxylate (PubChem CID 114403889) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is methyl 6-[2-cyanopropyl(ethyl)amino]-5-nitropyridine-2-carboxylate.
| Compound Name | methyl 6-[2-cyanopropyl(ethyl)amino]-5-nitropyridine-2-carboxylate |
|---|---|
| PubChem CID | 114403889 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | methyl 6-[2-cyanopropyl(ethyl)amino]-5-nitropyridine-2-carboxylate |
| SMILES | CCN(CC(C)C#N)c1nc(C(=O)OC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O4/c1-4-16(8-9(2)7-14)12-11(17(19)20)6-5-10(15-12)13(18)21-3/h5-6,9H,4,8H2,1-3H3 |
| InChIKey | BDFDKZAHKCFCDV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 109.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|