C23H28N2O3 — CID 11440401
6-(3,4-dimethoxyphenyl)-2-(5-phenylpentyl)-4,5-dihydropyridazin-3-one (PubChem CID 11440401) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-2-(5-phenylpentyl)-4,5-dihydropyridazin-3-one.
| Compound Name | 6-(3,4-dimethoxyphenyl)-2-(5-phenylpentyl)-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 11440401 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-2-(5-phenylpentyl)-4,5-dihydropyridazin-3-one |
| SMILES | COc1ccc(C2=NN(CCCCCc3ccccc3)C(=O)CC2)cc1OC |
| InChI | InChI=1S/C23H28N2O3/c1-27-21-14-12-19(17-22(21)28-2)20-13-15-23(26)25(24-20)16-8-4-7-11-18-9-5-3-6-10-18/h3,5-6,9-10,12,14,17H,4,7-8,11,13,15-16H2,1-2H3 |
| InChIKey | PWVKTJMOHHZXMC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|