C14H19N3O4 — CID 114404223
6-[(3,4-dimethylcyclohexyl)amino]-5-nitropyridine-2-carboxylic acid (PubChem CID 114404223) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 6-[(3,4-dimethylcyclohexyl)amino]-5-nitropyridine-2-carboxylic acid.
| Compound Name | 6-[(3,4-dimethylcyclohexyl)amino]-5-nitropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114404223 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 6-[(3,4-dimethylcyclohexyl)amino]-5-nitropyridine-2-carboxylic acid |
| SMILES | CC1CCC(Nc2nc(C(=O)O)ccc2[N+](=O)[O-])CC1C |
| InChI | InChI=1S/C14H19N3O4/c1-8-3-4-10(7-9(8)2)15-13-12(17(20)21)6-5-11(16-13)14(18)19/h5-6,8-10H,3-4,7H2,1-2H3,(H,15,16)(H,18,19) |
| InChIKey | XXDNHFITRUXXTF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|