C14H19ClN2O2 — CID 64733980
5-chloro-N-(3,4-dimethylcyclohexyl)-2-nitroaniline (PubChem CID 64733980) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 5-chloro-N-(3,4-dimethylcyclohexyl)-2-nitroaniline.
| Compound Name | 5-chloro-N-(3,4-dimethylcyclohexyl)-2-nitroaniline |
|---|---|
| PubChem CID | 64733980 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 5-chloro-N-(3,4-dimethylcyclohexyl)-2-nitroaniline |
| SMILES | CC1CCC(Nc2cc(Cl)ccc2[N+](=O)[O-])CC1C |
| InChI | InChI=1S/C14H19ClN2O2/c1-9-3-5-12(7-10(9)2)16-13-8-11(15)4-6-14(13)17(18)19/h4,6,8-10,12,16H,3,5,7H2,1-2H3 |
| InChIKey | GLPUXIVBKBKSJE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|