C16H22ClNO2 — CID 64733383
methyl 5-chloro-2-[(3,4-dimethylcyclohexyl)amino]benzoate (PubChem CID 64733383) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is methyl 5-chloro-2-[(3,4-dimethylcyclohexyl)amino]benzoate.
| Compound Name | methyl 5-chloro-2-[(3,4-dimethylcyclohexyl)amino]benzoate |
|---|---|
| PubChem CID | 64733383 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | methyl 5-chloro-2-[(3,4-dimethylcyclohexyl)amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1NC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C16H22ClNO2/c1-10-4-6-13(8-11(10)2)18-15-7-5-12(17)9-14(15)16(19)20-3/h5,7,9-11,13,18H,4,6,8H2,1-3H3 |
| InChIKey | HBCLGHILCBHSCQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |