C13H23NO2 — CID 114404645
4-[(2,6-dimethyloxan-4-yl)oxymethyl]-1,2,3,6-tetrahydropyridine (PubChem CID 114404645) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 4-[(2,6-dimethyloxan-4-yl)oxymethyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(2,6-dimethyloxan-4-yl)oxymethyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 114404645 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 4-[(2,6-dimethyloxan-4-yl)oxymethyl]-1,2,3,6-tetrahydropyridine |
| SMILES | CC1CC(OCC2=CCNCC2)CC(C)O1 |
| InChI | InChI=1S/C13H23NO2/c1-10-7-13(8-11(2)16-10)15-9-12-3-5-14-6-4-12/h3,10-11,13-14H,4-9H2,1-2H3 |
| InChIKey | BOOQJBRFJYYHIR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|