C25H23NO3 — CID 11440547
(2S)-4-benzhydryl-2-[(1R)-1-hydroxyethyl]-6-phenyl-1,4-oxazin-3-one (PubChem CID 11440547) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is (2S)-4-benzhydryl-2-[(1R)-1-hydroxyethyl]-6-phenyl-1,4-oxazin-3-one.
| Compound Name | (2S)-4-benzhydryl-2-[(1R)-1-hydroxyethyl]-6-phenyl-1,4-oxazin-3-one |
|---|---|
| PubChem CID | 11440547 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (2S)-4-benzhydryl-2-[(1R)-1-hydroxyethyl]-6-phenyl-1,4-oxazin-3-one |
| SMILES | C[C@@H](O)[C@@H]1OC(c2ccccc2)=CN(C(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C25H23NO3/c1-18(27)24-25(28)26(17-22(29-24)19-11-5-2-6-12-19)23(20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-18,23-24,27H,1H3/t18-,24+/m1/s1 |
| InChIKey | VOVPMBZJYBPJAI-KOSHJBKYSA-N |
| XLogP | 4.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |