C14H14BrN3O2 — CID 114405667
5-amino-6-[(4-bromophenyl)methyl-methylamino]pyridine-2-carboxylic acid (PubChem CID 114405667) has the molecular formula C14H14BrN3O2 and a molecular weight of 336.19 g/mol. Its IUPAC name is 5-amino-6-[(4-bromophenyl)methyl-methylamino]pyridine-2-carboxylic acid.
| Compound Name | 5-amino-6-[(4-bromophenyl)methyl-methylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114405667 |
| Molecular Formula | C14H14BrN3O2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 5-amino-6-[(4-bromophenyl)methyl-methylamino]pyridine-2-carboxylic acid |
| SMILES | CN(Cc1ccc(Br)cc1)c1nc(C(=O)O)ccc1N |
| InChI | InChI=1S/C14H14BrN3O2/c1-18(8-9-2-4-10(15)5-3-9)13-11(16)6-7-12(17-13)14(19)20/h2-7H,8,16H2,1H3,(H,19,20) |
| InChIKey | BFCPINJYPRZRTQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |