C13H14BrN3O2S — CID 114405984
methyl 5-amino-6-[(5-bromothiophen-3-yl)methyl-methylamino]pyridine-2-carboxylate (PubChem CID 114405984) has the molecular formula C13H14BrN3O2S and a molecular weight of 356.25 g/mol. Its IUPAC name is methyl 5-amino-6-[(5-bromothiophen-3-yl)methyl-methylamino]pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-[(5-bromothiophen-3-yl)methyl-methylamino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114405984 |
| Molecular Formula | C13H14BrN3O2S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | methyl 5-amino-6-[(5-bromothiophen-3-yl)methyl-methylamino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(N(C)Cc2csc(Br)c2)n1 |
| InChI | InChI=1S/C13H14BrN3O2S/c1-17(6-8-5-11(14)20-7-8)12-9(15)3-4-10(16-12)13(18)19-2/h3-5,7H,6,15H2,1-2H3 |
| InChIKey | GITXWZKUYOSZEQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |