C12H12BrN3O2S — CID 66452032
methyl 6-[(5-bromothiophen-3-yl)methyl-methylamino]pyrazine-2-carboxylate (PubChem CID 66452032) has the molecular formula C12H12BrN3O2S and a molecular weight of 342.22 g/mol. Its IUPAC name is methyl 6-[(5-bromothiophen-3-yl)methyl-methylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[(5-bromothiophen-3-yl)methyl-methylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66452032 |
| Molecular Formula | C12H12BrN3O2S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | methyl 6-[(5-bromothiophen-3-yl)methyl-methylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(N(C)Cc2csc(Br)c2)n1 |
| InChI | InChI=1S/C12H12BrN3O2S/c1-16(6-8-3-10(13)19-7-8)11-5-14-4-9(15-11)12(17)18-2/h3-5,7H,6H2,1-2H3 |
| InChIKey | JHEBBDDGEZAXAR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |