C15H23N3O3 — CID 114406087
methyl 5-amino-6-[1-cyclopropylethyl(2-methoxyethyl)amino]pyridine-2-carboxylate (PubChem CID 114406087) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl 5-amino-6-[1-cyclopropylethyl(2-methoxyethyl)amino]pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-[1-cyclopropylethyl(2-methoxyethyl)amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114406087 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | methyl 5-amino-6-[1-cyclopropylethyl(2-methoxyethyl)amino]pyridine-2-carboxylate |
| SMILES | COCCN(c1nc(C(=O)OC)ccc1N)C(C)C1CC1 |
| InChI | InChI=1S/C15H23N3O3/c1-10(11-4-5-11)18(8-9-20-2)14-12(16)6-7-13(17-14)15(19)21-3/h6-7,10-11H,4-5,8-9,16H2,1-3H3 |
| InChIKey | AELLHNVMCSVCSW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |