C14H23N3O3 — CID 114405986
methyl 5-amino-6-[2-methoxyethyl(2-methylpropyl)amino]pyridine-2-carboxylate (PubChem CID 114405986) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 5-amino-6-[2-methoxyethyl(2-methylpropyl)amino]pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-[2-methoxyethyl(2-methylpropyl)amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114405986 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | methyl 5-amino-6-[2-methoxyethyl(2-methylpropyl)amino]pyridine-2-carboxylate |
| SMILES | COCCN(CC(C)C)c1nc(C(=O)OC)ccc1N |
| InChI | InChI=1S/C14H23N3O3/c1-10(2)9-17(7-8-19-3)13-11(15)5-6-12(16-13)14(18)20-4/h5-6,10H,7-9,15H2,1-4H3 |
| InChIKey | UKFIGBWTELOYBN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |