C14H20N4O2 — CID 114406141
methyl 5-amino-6-[2-cyanoethyl(2-methylpropyl)amino]pyridine-2-carboxylate (PubChem CID 114406141) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl 5-amino-6-[2-cyanoethyl(2-methylpropyl)amino]pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-[2-cyanoethyl(2-methylpropyl)amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114406141 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | methyl 5-amino-6-[2-cyanoethyl(2-methylpropyl)amino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(N(CCC#N)CC(C)C)n1 |
| InChI | InChI=1S/C14H20N4O2/c1-10(2)9-18(8-4-7-15)13-11(16)5-6-12(17-13)14(19)20-3/h5-6,10H,4,8-9,16H2,1-3H3 |
| InChIKey | LQFYSIOQVOUTCQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |