C11H15N5O2 — CID 114406770
5-amino-6-[(5-oxopyrrolidin-2-yl)methylamino]pyridine-2-carboxamide (PubChem CID 114406770) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-amino-6-[(5-oxopyrrolidin-2-yl)methylamino]pyridine-2-carboxamide.
| Compound Name | 5-amino-6-[(5-oxopyrrolidin-2-yl)methylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114406770 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 5-amino-6-[(5-oxopyrrolidin-2-yl)methylamino]pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(N)c(NCC2CCC(=O)N2)n1 |
| InChI | InChI=1S/C11H15N5O2/c12-7-2-3-8(10(13)18)16-11(7)14-5-6-1-4-9(17)15-6/h2-3,6H,1,4-5,12H2,(H2,13,18)(H,14,16)(H,15,17) |
| InChIKey | ZUMARHVDNHTKIP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |