C9H13ClN6O — CID 80917435
5-[[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]methyl]pyrrolidin-2-one (PubChem CID 80917435) has the molecular formula C9H13ClN6O and a molecular weight of 256.70 g/mol. Its IUPAC name is 5-[[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]methyl]pyrrolidin-2-one.
| Compound Name | 5-[[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 80917435 |
| Molecular Formula | C9H13ClN6O |
| Molecular Weight | 256.70 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-[[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]methyl]pyrrolidin-2-one |
| SMILES | NNc1ncc(Cl)c(NCC2CCC(=O)N2)n1 |
| InChI | InChI=1S/C9H13ClN6O/c10-6-4-13-9(16-11)15-8(6)12-3-5-1-2-7(17)14-5/h4-5H,1-3,11H2,(H,14,17)(H2,12,13,15,16) |
| InChIKey | HORCNLUWQQBNCT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.70 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|