C12H14F2N2O2S — CID 114407733
3,4-difluoro-5-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline (PubChem CID 114407733) has the molecular formula C12H14F2N2O2S and a molecular weight of 288.32 g/mol. Its IUPAC name is 3,4-difluoro-5-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline.
| Compound Name | 3,4-difluoro-5-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 114407733 |
| Molecular Formula | C12H14F2N2O2S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3,4-difluoro-5-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline |
| SMILES | CC1=CCN(S(=O)(=O)c2cc(N)cc(F)c2F)CC1 |
| InChI | InChI=1S/C12H14F2N2O2S/c1-8-2-4-16(5-3-8)19(17,18)11-7-9(15)6-10(13)12(11)14/h2,6-7H,3-5,15H2,1H3 |
| InChIKey | BYIDYMSPYFOVPN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|