C14H18F2N2O2S — CID 114414393
1-[2,6-difluoro-3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]-N-methylmethanamine (PubChem CID 114414393) has the molecular formula C14H18F2N2O2S and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-[2,6-difluoro-3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]-N-methylmethanamine.
| Compound Name | 1-[2,6-difluoro-3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114414393 |
| Molecular Formula | C14H18F2N2O2S |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-[2,6-difluoro-3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]-N-methylmethanamine |
| SMILES | CNCc1c(F)ccc(S(=O)(=O)N2CC=C(C)CC2)c1F |
| InChI | InChI=1S/C14H18F2N2O2S/c1-10-5-7-18(8-6-10)21(19,20)13-4-3-12(15)11(9-17-2)14(13)16/h3-5,17H,6-9H2,1-2H3 |
| InChIKey | LOPVIRKKCRKJDL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|