C16H32INO2 — CID 11440892
(2R,3R)-2-hydroxy-3-iodo-N,N-di(propan-2-yl)decanamide (PubChem CID 11440892) has the molecular formula C16H32INO2 and a molecular weight of 397.34 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-3-iodo-N,N-di(propan-2-yl)decanamide.
| Compound Name | (2R,3R)-2-hydroxy-3-iodo-N,N-di(propan-2-yl)decanamide |
|---|---|
| PubChem CID | 11440892 |
| Molecular Formula | C16H32INO2 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2R,3R)-2-hydroxy-3-iodo-N,N-di(propan-2-yl)decanamide |
| SMILES | CCCCCCC[C@@H](I)[C@H](O)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H32INO2/c1-6-7-8-9-10-11-14(17)15(19)16(20)18(12(2)3)13(4)5/h12-15,19H,6-11H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | ZIJFWFKMGOIINP-CABCVRRESA-N |
| XLogP | 4.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|