C15H28INO2 — CID 11361014
(2R,3R)-3-cyclohexyl-2-hydroxy-3-iodo-N,N-di(propan-2-yl)propanamide (PubChem CID 11361014) has the molecular formula C15H28INO2 and a molecular weight of 381.30 g/mol. Its IUPAC name is (2R,3R)-3-cyclohexyl-2-hydroxy-3-iodo-N,N-di(propan-2-yl)propanamide.
| Compound Name | (2R,3R)-3-cyclohexyl-2-hydroxy-3-iodo-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 11361014 |
| Molecular Formula | C15H28INO2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (2R,3R)-3-cyclohexyl-2-hydroxy-3-iodo-N,N-di(propan-2-yl)propanamide |
| SMILES | CC(C)N(C(=O)[C@@H](O)[C@H](I)C1CCCCC1)C(C)C |
| InChI | InChI=1S/C15H28INO2/c1-10(2)17(11(3)4)15(19)14(18)13(16)12-8-6-5-7-9-12/h10-14,18H,5-9H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | PJLNOIHDJPBWOC-KGLIPLIRSA-N |
| XLogP | 3.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|