C11H18N2O3 — CID 114409532
ethyl 2-amino-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-oxopropanoate (PubChem CID 114409532) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl 2-amino-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 114409532 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethyl 2-amino-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)N1CC=C(C)CC1 |
| InChI | InChI=1S/C11H18N2O3/c1-3-16-11(15)9(12)10(14)13-6-4-8(2)5-7-13/h4,9H,3,5-7,12H2,1-2H3 |
| InChIKey | HKMPWCWGUKHBGB-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|