C10H16N2O3 — CID 114409125
ethyl 2-amino-3-(3,6-dihydro-2H-pyridin-1-yl)-3-oxopropanoate (PubChem CID 114409125) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is ethyl 2-amino-3-(3,6-dihydro-2H-pyridin-1-yl)-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-(3,6-dihydro-2H-pyridin-1-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 114409125 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethyl 2-amino-3-(3,6-dihydro-2H-pyridin-1-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)N1CC=CCC1 |
| InChI | InChI=1S/C10H16N2O3/c1-2-15-10(14)8(11)9(13)12-6-4-3-5-7-12/h3-4,8H,2,5-7,11H2,1H3 |
| InChIKey | FHTVGFHEXKBBJB-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|