methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate

C12H16N2O2S — CID 114409662

IUPACmethyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate
SMILESCOC(=O)c1ccc(N)c(SC2CCCC2)n1
InChIInChI=1S/C12H16N2O2S/c1-16-12(15)10-7-6-9(13)11(14-10)17-8-4-2-3-5-8/h6-8H,2-5,13H2,1H3
InChIKeyOUWLVAKMKRDWAJ-UHFFFAOYSA-N
MW252.34 g/mol
LogP2.49
Rot. Bonds3

About methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate

methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate (PubChem CID 114409662) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate
PubChem CID114409662
Molecular FormulaC12H16N2O2S
Molecular Weight252.34 g/mol
Exact Mass252.09
IUPAC Namemethyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate
SMILESCOC(=O)c1ccc(N)c(SC2CCCC2)n1
InChIInChI=1S/C12H16N2O2S/c1-16-12(15)10-7-6-9(13)11(14-10)17-8-4-2-3-5-8/h6-8H,2-5,13H2,1H3
InChIKeyOUWLVAKMKRDWAJ-UHFFFAOYSA-N
XLogP2.49
TPSA65.21 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.34
LogP ≤ 52.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate?
The IUPAC name of methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate (CID 114409662) is methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate.
What is the SMILES notation for methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate?
The canonical SMILES for methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate is COC(=O)c1ccc(N)c(SC2CCCC2)n1.
What is the InChIKey of methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate?
The InChIKey is OUWLVAKMKRDWAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2S/c1-16-12(15)10-7-6-9(13)11(14-10)17-8-4-2-3-5-8/h6-8H,2-5,13H2,1H3.
What are the key properties of methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate?
methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate has a molecular weight of 252.34 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-6-cyclopentylsulfanylpyridine-2-carboxylate is sourced from PubChem (CID 114409662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).