C10H14N2O3S — CID 114409757
methyl 5-amino-6-(3-hydroxypropylsulfanyl)pyridine-2-carboxylate (PubChem CID 114409757) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is methyl 5-amino-6-(3-hydroxypropylsulfanyl)pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-(3-hydroxypropylsulfanyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114409757 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | methyl 5-amino-6-(3-hydroxypropylsulfanyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(SCCCO)n1 |
| InChI | InChI=1S/C10H14N2O3S/c1-15-10(14)8-4-3-7(11)9(12-8)16-6-2-5-13/h3-4,13H,2,5-6,11H2,1H3 |
| InChIKey | TUCZJSANPMZRLQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|