C10H18N2O2 — CID 114409760
2-amino-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one (PubChem CID 114409760) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-amino-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one.
| Compound Name | 2-amino-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 114409760 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-amino-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
| SMILES | COCC1=CCN(C(=O)C(C)N)CC1 |
| InChI | InChI=1S/C10H18N2O2/c1-8(11)10(13)12-5-3-9(4-6-12)7-14-2/h3,8H,4-7,11H2,1-2H3 |
| InChIKey | IBAZYAINIWXJKS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|