C9H16N2O2 — CID 114401798
4-(methoxymethyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 114401798) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | 4-(methoxymethyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 114401798 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 4-(methoxymethyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CNC(=O)N1CC=C(COC)CC1 |
| InChI | InChI=1S/C9H16N2O2/c1-10-9(12)11-5-3-8(4-6-11)7-13-2/h3H,4-7H2,1-2H3,(H,10,12) |
| InChIKey | IQKAGBAISWFAKC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|