C9H16N2OS — CID 130621040
4-(methoxymethyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carbothioamide (PubChem CID 130621040) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carbothioamide.
| Compound Name | 4-(methoxymethyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 130621040 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-(methoxymethyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
| SMILES | CNC(=S)N1CC=C(COC)CC1 |
| InChI | InChI=1S/C9H16N2OS/c1-10-9(13)11-5-3-8(4-6-11)7-12-2/h3H,4-7H2,1-2H3,(H,10,13) |
| InChIKey | JSYRHKXHEXJGRH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|