C11H17ClN2O3 — CID 114412228
N-(3-chloropropanoyl)-4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 114412228) has the molecular formula C11H17ClN2O3 and a molecular weight of 260.72 g/mol. Its IUPAC name is N-(3-chloropropanoyl)-4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-(3-chloropropanoyl)-4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 114412228 |
| Molecular Formula | C11H17ClN2O3 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-(3-chloropropanoyl)-4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | COCC1=CCN(C(=O)NC(=O)CCCl)CC1 |
| InChI | InChI=1S/C11H17ClN2O3/c1-17-8-9-3-6-14(7-4-9)11(16)13-10(15)2-5-12/h3H,2,4-8H2,1H3,(H,13,15,16) |
| InChIKey | UXGZVZCLSVDZLY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|