C8H11ClN2O2 — CID 130627534
N-(3-chloropropanoyl)-2,5-dihydropyrrole-1-carboxamide (PubChem CID 130627534) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is N-(3-chloropropanoyl)-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | N-(3-chloropropanoyl)-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 130627534 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | N-(3-chloropropanoyl)-2,5-dihydropyrrole-1-carboxamide |
| SMILES | O=C(CCCl)NC(=O)N1CC=CC1 |
| InChI | InChI=1S/C8H11ClN2O2/c9-4-3-7(12)10-8(13)11-5-1-2-6-11/h1-2H,3-6H2,(H,10,12,13) |
| InChIKey | LCYGEQCGISUMML-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|